C27H41NO5 — CID 110145542
tert-butyl (4aS,5S,10bS)-7-methoxy-5-methyl-5-(4-methylpentyl)spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,3'-azetidine]-1'-carboxylate (PubChem CID 110145542) has the molecular formula C27H41NO5 and a molecular weight of 459.63 g/mol. Its IUPAC name is tert-butyl (4aS,5S,10bS)-7-methoxy-5-methyl-5-(4-methylpentyl)spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,3'-azetidine]-1'-carboxylate.
| Compound Name | tert-butyl (4aS,5S,10bS)-7-methoxy-5-methyl-5-(4-methylpentyl)spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,3'-azetidine]-1'-carboxylate |
|---|---|
| PubChem CID | 110145542 |
| Molecular Formula | C27H41NO5 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.30 |
| IUPAC Name | tert-butyl (4aS,5S,10bS)-7-methoxy-5-methyl-5-(4-methylpentyl)spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,3'-azetidine]-1'-carboxylate |
| SMILES | COc1cccc2c1O[C@@](C)(CCCC(C)C)[C@H]1CC3(CO[C@H]21)CN(C(=O)OC(C)(C)C)C3 |
| InChI | InChI=1S/C27H41NO5/c1-18(2)10-9-13-26(6)20-14-27(15-28(16-27)24(29)33-25(3,4)5)17-31-22(20)19-11-8-12-21(30-7)23(19)32-26/h8,11-12,18,20,22H,9-10,13-17H2,1-7H3/t20-,22+,26-/m0/s1 |
| InChIKey | WYLPMPHUFJSKBF-HXAGEGRHSA-N |
| XLogP | 5.99 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |