C28H41NO5 — CID 110145094
tert-butyl (3S,4aS,5R,10bS)-7-hydroxy-5-methyl-5-(4-methylpent-3-enyl)spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,3'-piperidine]-1'-carboxylate (PubChem CID 110145094) has the molecular formula C28H41NO5 and a molecular weight of 471.64 g/mol. Its IUPAC name is tert-butyl (3S,4aS,5R,10bS)-7-hydroxy-5-methyl-5-(4-methylpent-3-enyl)spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,3'-piperidine]-1'-carboxylate.
| Compound Name | tert-butyl (3S,4aS,5R,10bS)-7-hydroxy-5-methyl-5-(4-methylpent-3-enyl)spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,3'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 110145094 |
| Molecular Formula | C28H41NO5 |
| Molecular Weight | 471.64 g/mol |
| Exact Mass | 471.30 |
| IUPAC Name | tert-butyl (3S,4aS,5R,10bS)-7-hydroxy-5-methyl-5-(4-methylpent-3-enyl)spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,3'-piperidine]-1'-carboxylate |
| SMILES | CC(C)=CCC[C@@]1(C)Oc2c(O)cccc2[C@H]2OC[C@@]3(CCCN(C(=O)OC(C)(C)C)C3)C[C@@H]21 |
| InChI | InChI=1S/C28H41NO5/c1-19(2)10-8-13-27(6)21-16-28(14-9-15-29(17-28)25(31)34-26(3,4)5)18-32-23(21)20-11-7-12-22(30)24(20)33-27/h7,10-12,21,23,30H,8-9,13-18H2,1-6H3/t21-,23+,27+,28-/m0/s1 |
| InChIKey | PBDQYQGRHKPCGM-KBGRTBIMSA-N |
| XLogP | 6.38 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.64 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|