C29H41NO5 — CID 110161475
3-[(3S,4aS,5R,10bS)-1'-(3-cyclohexylpropanoyl)-5-methylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,3'-piperidine]-5-yl]propanoic acid (PubChem CID 110161475) has the molecular formula C29H41NO5 and a molecular weight of 483.65 g/mol. Its IUPAC name is 3-[(3S,4aS,5R,10bS)-1'-(3-cyclohexylpropanoyl)-5-methylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,3'-piperidine]-5-yl]propanoic acid.
| Compound Name | 3-[(3S,4aS,5R,10bS)-1'-(3-cyclohexylpropanoyl)-5-methylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,3'-piperidine]-5-yl]propanoic acid |
|---|---|
| PubChem CID | 110161475 |
| Molecular Formula | C29H41NO5 |
| Molecular Weight | 483.65 g/mol |
| Exact Mass | 483.30 |
| IUPAC Name | 3-[(3S,4aS,5R,10bS)-1'-(3-cyclohexylpropanoyl)-5-methylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,3'-piperidine]-5-yl]propanoic acid |
| SMILES | C[C@]1(CCC(=O)O)Oc2ccccc2[C@H]2OC[C@@]3(CCCN(C(=O)CCC4CCCCC4)C3)C[C@@H]21 |
| InChI | InChI=1S/C29H41NO5/c1-28(16-14-26(32)33)23-18-29(20-34-27(23)22-10-5-6-11-24(22)35-28)15-7-17-30(19-29)25(31)13-12-21-8-3-2-4-9-21/h5-6,10-11,21,23,27H,2-4,7-9,12-20H2,1H3,(H,32,33)/t23-,27+,28+,29-/m0/s1 |
| InChIKey | STHQGUQAUHJMNC-QHGKVXFQSA-N |
| XLogP | 5.75 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.65 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |