C28H37N3O5 — CID 110161119
3-[(4aR,5S,10bR)-1'-(5-tert-butyl-1H-pyrazole-3-carbonyl)-5-methylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-5-yl]propanoic acid (PubChem CID 110161119) has the molecular formula C28H37N3O5 and a molecular weight of 495.62 g/mol. Its IUPAC name is 3-[(4aR,5S,10bR)-1'-(5-tert-butyl-1H-pyrazole-3-carbonyl)-5-methylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-5-yl]propanoic acid.
| Compound Name | 3-[(4aR,5S,10bR)-1'-(5-tert-butyl-1H-pyrazole-3-carbonyl)-5-methylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-5-yl]propanoic acid |
|---|---|
| PubChem CID | 110161119 |
| Molecular Formula | C28H37N3O5 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.27 |
| IUPAC Name | 3-[(4aR,5S,10bR)-1'-(5-tert-butyl-1H-pyrazole-3-carbonyl)-5-methylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-5-yl]propanoic acid |
| SMILES | CC(C)(C)c1cc(C(=O)N2CCC3(CC2)CO[C@H]2c4ccccc4O[C@@](C)(CCC(=O)O)[C@@H]2C3)n[nH]1 |
| InChI | InChI=1S/C28H37N3O5/c1-26(2,3)22-15-20(29-30-22)25(34)31-13-11-28(12-14-31)16-19-24(35-17-28)18-7-5-6-8-21(18)36-27(19,4)10-9-23(32)33/h5-8,15,19,24H,9-14,16-17H2,1-4H3,(H,29,30)(H,32,33)/t19-,24+,27+/m1/s1 |
| InChIKey | QGOLWTKGAPWWKR-WMEMMNBJSA-N |
| XLogP | 4.72 |
| TPSA | 104.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |