C25H35NO6 — CID 155988198
3-[(4aS,5R,10bS)-1'-(3,3-dimethylbutanoyl)-8-methoxy-5-methylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,3'-azetidine]-5-yl]propanoic acid (PubChem CID 155988198) has the molecular formula C25H35NO6 and a molecular weight of 445.56 g/mol. Its IUPAC name is 3-[(4aS,5R,10bS)-1'-(3,3-dimethylbutanoyl)-8-methoxy-5-methylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,3'-azetidine]-5-yl]propanoic acid.
| Compound Name | 3-[(4aS,5R,10bS)-1'-(3,3-dimethylbutanoyl)-8-methoxy-5-methylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,3'-azetidine]-5-yl]propanoic acid |
|---|---|
| PubChem CID | 155988198 |
| Molecular Formula | C25H35NO6 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | 3-[(4aS,5R,10bS)-1'-(3,3-dimethylbutanoyl)-8-methoxy-5-methylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,3'-azetidine]-5-yl]propanoic acid |
| SMILES | COc1ccc2c(c1)O[C@](C)(CCC(=O)O)[C@H]1CC3(CO[C@H]21)CN(C(=O)CC(C)(C)C)C3 |
| InChI | InChI=1S/C25H35NO6/c1-23(2,3)12-20(27)26-13-25(14-26)11-18-22(31-15-25)17-7-6-16(30-5)10-19(17)32-24(18,4)9-8-21(28)29/h6-7,10,18,22H,8-9,11-15H2,1-5H3,(H,28,29)/t18-,22+,24+/m0/s1 |
| InChIKey | QPUKNOPRSOZCSL-KUWBRRTOSA-N |
| XLogP | 4.05 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |