C23H28N2O4S — CID 110142671
[(4aS,10bS)-9-methoxy-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl]-(1,3-thiazol-5-yl)methanone (PubChem CID 110142671) has the molecular formula C23H28N2O4S and a molecular weight of 428.55 g/mol. Its IUPAC name is [(4aS,10bS)-9-methoxy-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl]-(1,3-thiazol-5-yl)methanone.
| Compound Name | [(4aS,10bS)-9-methoxy-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl]-(1,3-thiazol-5-yl)methanone |
|---|---|
| PubChem CID | 110142671 |
| Molecular Formula | C23H28N2O4S |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | [(4aS,10bS)-9-methoxy-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl]-(1,3-thiazol-5-yl)methanone |
| SMILES | COc1ccc2c(c1)[C@H]1OCC3(CCN(C(=O)c4cncs4)CC3)C[C@@H]1C(C)(C)O2 |
| InChI | InChI=1S/C23H28N2O4S/c1-22(2)17-11-23(6-8-25(9-7-23)21(26)19-12-24-14-30-19)13-28-20(17)16-10-15(27-3)4-5-18(16)29-22/h4-5,10,12,14,17,20H,6-9,11,13H2,1-3H3/t17-,20+/m0/s1 |
| InChIKey | WGEDBMPLPUUYGT-FXAWDEMLSA-N |
| XLogP | 4.32 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |