C28H33N3O4 — CID 110142828
1-[(4aS,10bS)-9-methoxy-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl]-2-(benzimidazol-1-yl)ethanone (PubChem CID 110142828) has the molecular formula C28H33N3O4 and a molecular weight of 475.59 g/mol. Its IUPAC name is 1-[(4aS,10bS)-9-methoxy-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl]-2-(benzimidazol-1-yl)ethanone.
| Compound Name | 1-[(4aS,10bS)-9-methoxy-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl]-2-(benzimidazol-1-yl)ethanone |
|---|---|
| PubChem CID | 110142828 |
| Molecular Formula | C28H33N3O4 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | 1-[(4aS,10bS)-9-methoxy-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl]-2-(benzimidazol-1-yl)ethanone |
| SMILES | COc1ccc2c(c1)[C@H]1OCC3(CCN(C(=O)Cn4cnc5ccccc54)CC3)C[C@@H]1C(C)(C)O2 |
| InChI | InChI=1S/C28H33N3O4/c1-27(2)21-15-28(17-34-26(21)20-14-19(33-3)8-9-24(20)35-27)10-12-30(13-11-28)25(32)16-31-18-29-22-6-4-5-7-23(22)31/h4-9,14,18,21,26H,10-13,15-17H2,1-3H3/t21-,26+/m0/s1 |
| InChIKey | RMKVPHDWWNUVMM-HFZDXXHNSA-N |
| XLogP | 4.60 |
| TPSA | 65.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |