C27H33NO5 — CID 110142766
1-[(4aS,10bS)-9-methoxy-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl]-2-phenoxyethanone (PubChem CID 110142766) has the molecular formula C27H33NO5 and a molecular weight of 451.56 g/mol. Its IUPAC name is 1-[(4aS,10bS)-9-methoxy-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl]-2-phenoxyethanone.
| Compound Name | 1-[(4aS,10bS)-9-methoxy-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl]-2-phenoxyethanone |
|---|---|
| PubChem CID | 110142766 |
| Molecular Formula | C27H33NO5 |
| Molecular Weight | 451.56 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | 1-[(4aS,10bS)-9-methoxy-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl]-2-phenoxyethanone |
| SMILES | COc1ccc2c(c1)[C@H]1OCC3(CCN(C(=O)COc4ccccc4)CC3)C[C@@H]1C(C)(C)O2 |
| InChI | InChI=1S/C27H33NO5/c1-26(2)22-16-27(18-32-25(22)21-15-20(30-3)9-10-23(21)33-26)11-13-28(14-12-27)24(29)17-31-19-7-5-4-6-8-19/h4-10,15,22,25H,11-14,16-18H2,1-3H3/t22-,25+/m0/s1 |
| InChIKey | LYSQLFPEMUEVIY-WIOPSUGQSA-N |
| XLogP | 4.63 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.56 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |