C24H30ClN3O4 — CID 155921747
1-(9-chloro-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl)-2-[2-(hydroxymethyl)imidazol-1-yl]ethanone (PubChem CID 155921747) has the molecular formula C24H30ClN3O4 and a molecular weight of 459.97 g/mol. Its IUPAC name is 1-(9-chloro-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl)-2-[2-(hydroxymethyl)imidazol-1-yl]ethanone.
| Compound Name | 1-(9-chloro-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl)-2-[2-(hydroxymethyl)imidazol-1-yl]ethanone |
|---|---|
| PubChem CID | 155921747 |
| Molecular Formula | C24H30ClN3O4 |
| Molecular Weight | 459.97 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | 1-(9-chloro-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl)-2-[2-(hydroxymethyl)imidazol-1-yl]ethanone |
| SMILES | CC1(C)Oc2ccc(Cl)cc2C2OCC3(CCN(C(=O)Cn4ccnc4CO)CC3)CC21 |
| InChI | InChI=1S/C24H30ClN3O4/c1-23(2)18-12-24(15-31-22(18)17-11-16(25)3-4-19(17)32-23)5-8-27(9-6-24)21(30)13-28-10-7-26-20(28)14-29/h3-4,7,10-11,18,22,29H,5-6,8-9,12-15H2,1-2H3 |
| InChIKey | IOXNMJRBYAMCQG-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.97 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |