C24H30ClN3O3 — CID 155921737
1-(8-chloro-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl)-2-(2-methylimidazol-1-yl)ethanone (PubChem CID 155921737) has the molecular formula C24H30ClN3O3 and a molecular weight of 443.98 g/mol. Its IUPAC name is 1-(8-chloro-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl)-2-(2-methylimidazol-1-yl)ethanone.
| Compound Name | 1-(8-chloro-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl)-2-(2-methylimidazol-1-yl)ethanone |
|---|---|
| PubChem CID | 155921737 |
| Molecular Formula | C24H30ClN3O3 |
| Molecular Weight | 443.98 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | 1-(8-chloro-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl)-2-(2-methylimidazol-1-yl)ethanone |
| SMILES | Cc1nccn1CC(=O)N1CCC2(CC1)COC1c3ccc(Cl)cc3OC(C)(C)C1C2 |
| InChI | InChI=1S/C24H30ClN3O3/c1-16-26-8-11-28(16)14-21(29)27-9-6-24(7-10-27)13-19-22(30-15-24)18-5-4-17(25)12-20(18)31-23(19,2)3/h4-5,8,11-12,19,22H,6-7,9-10,13-15H2,1-3H3 |
| InChIKey | WKUDBMCPZNQLAB-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.98 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |