C25H33N3O3 — CID 110142714
1-[(4aS,10bS)-5,5,8-trimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl]-2-(4-methylpyrazol-1-yl)ethanone (PubChem CID 110142714) has the molecular formula C25H33N3O3 and a molecular weight of 423.56 g/mol. Its IUPAC name is 1-[(4aS,10bS)-5,5,8-trimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl]-2-(4-methylpyrazol-1-yl)ethanone.
| Compound Name | 1-[(4aS,10bS)-5,5,8-trimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl]-2-(4-methylpyrazol-1-yl)ethanone |
|---|---|
| PubChem CID | 110142714 |
| Molecular Formula | C25H33N3O3 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | 1-[(4aS,10bS)-5,5,8-trimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl]-2-(4-methylpyrazol-1-yl)ethanone |
| SMILES | Cc1ccc2c(c1)OC(C)(C)[C@H]1CC3(CCN(C(=O)Cn4cc(C)cn4)CC3)CO[C@H]21 |
| InChI | InChI=1S/C25H33N3O3/c1-17-5-6-19-21(11-17)31-24(3,4)20-12-25(16-30-23(19)20)7-9-27(10-8-25)22(29)15-28-14-18(2)13-26-28/h5-6,11,13-14,20,23H,7-10,12,15-16H2,1-4H3/t20-,23+/m0/s1 |
| InChIKey | VNUQTFOTEXWQQO-NZQKXSOJSA-N |
| XLogP | 4.06 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |