C26H33N3O3 — CID 110142770
[(4aS,10bS)-5,5,8-trimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl]-(2,4-dimethylpyrimidin-5-yl)methanone (PubChem CID 110142770) has the molecular formula C26H33N3O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is [(4aS,10bS)-5,5,8-trimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl]-(2,4-dimethylpyrimidin-5-yl)methanone.
| Compound Name | [(4aS,10bS)-5,5,8-trimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl]-(2,4-dimethylpyrimidin-5-yl)methanone |
|---|---|
| PubChem CID | 110142770 |
| Molecular Formula | C26H33N3O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | [(4aS,10bS)-5,5,8-trimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl]-(2,4-dimethylpyrimidin-5-yl)methanone |
| SMILES | Cc1ccc2c(c1)OC(C)(C)[C@H]1CC3(CCN(C(=O)c4cnc(C)nc4C)CC3)CO[C@H]21 |
| InChI | InChI=1S/C26H33N3O3/c1-16-6-7-19-22(12-16)32-25(4,5)21-13-26(15-31-23(19)21)8-10-29(11-9-26)24(30)20-14-27-18(3)28-17(20)2/h6-7,12,14,21,23H,8-11,13,15H2,1-5H3/t21-,23+/m0/s1 |
| InChIKey | FONOZFFCSBFVBD-JTHBVZDNSA-N |
| XLogP | 4.57 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |