C25H30N2O4 — CID 110142618
[(4aS,10bS)-7-methoxy-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl]-pyridin-2-ylmethanone (PubChem CID 110142618) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is [(4aS,10bS)-7-methoxy-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl]-pyridin-2-ylmethanone.
| Compound Name | [(4aS,10bS)-7-methoxy-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 110142618 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | [(4aS,10bS)-7-methoxy-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl]-pyridin-2-ylmethanone |
| SMILES | COc1cccc2c1OC(C)(C)[C@H]1CC3(CCN(C(=O)c4ccccn4)CC3)CO[C@H]21 |
| InChI | InChI=1S/C25H30N2O4/c1-24(2)18-15-25(10-13-27(14-11-25)23(28)19-8-4-5-12-26-19)16-30-21(18)17-7-6-9-20(29-3)22(17)31-24/h4-9,12,18,21H,10-11,13-16H2,1-3H3/t18-,21+/m0/s1 |
| InChIKey | AHZVCNAXHXPKCZ-GHTZIAJQSA-N |
| XLogP | 4.26 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |