C26H35N3O3 — CID 110142641
(4aS,10bS)-7-ethoxy-5,5-dimethyl-1'-[(2-methylpyrimidin-4-yl)methyl]spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine] (PubChem CID 110142641) has the molecular formula C26H35N3O3 and a molecular weight of 437.58 g/mol. Its IUPAC name is (4aS,10bS)-7-ethoxy-5,5-dimethyl-1'-[(2-methylpyrimidin-4-yl)methyl]spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine].
| Compound Name | (4aS,10bS)-7-ethoxy-5,5-dimethyl-1'-[(2-methylpyrimidin-4-yl)methyl]spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine] |
|---|---|
| PubChem CID | 110142641 |
| Molecular Formula | C26H35N3O3 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | (4aS,10bS)-7-ethoxy-5,5-dimethyl-1'-[(2-methylpyrimidin-4-yl)methyl]spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine] |
| SMILES | CCOc1cccc2c1OC(C)(C)[C@H]1CC3(CCN(Cc4ccnc(C)n4)CC3)CO[C@H]21 |
| InChI | InChI=1S/C26H35N3O3/c1-5-30-22-8-6-7-20-23-21(25(3,4)32-24(20)22)15-26(17-31-23)10-13-29(14-11-26)16-19-9-12-27-18(2)28-19/h6-9,12,21,23H,5,10-11,13-17H2,1-4H3/t21-,23+/m0/s1 |
| InChIKey | BCENOTOJOGDSLX-JTHBVZDNSA-N |
| XLogP | 4.71 |
| TPSA | 56.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |