C28H43NO5 — CID 110145541
tert-butyl (4aS,5R,10bS)-7-ethoxy-5-methyl-5-(4-methylpentyl)spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,3'-azetidine]-1'-carboxylate (PubChem CID 110145541) has the molecular formula C28H43NO5 and a molecular weight of 473.65 g/mol. Its IUPAC name is tert-butyl (4aS,5R,10bS)-7-ethoxy-5-methyl-5-(4-methylpentyl)spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,3'-azetidine]-1'-carboxylate.
| Compound Name | tert-butyl (4aS,5R,10bS)-7-ethoxy-5-methyl-5-(4-methylpentyl)spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,3'-azetidine]-1'-carboxylate |
|---|---|
| PubChem CID | 110145541 |
| Molecular Formula | C28H43NO5 |
| Molecular Weight | 473.65 g/mol |
| Exact Mass | 473.31 |
| IUPAC Name | tert-butyl (4aS,5R,10bS)-7-ethoxy-5-methyl-5-(4-methylpentyl)spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,3'-azetidine]-1'-carboxylate |
| SMILES | CCOc1cccc2c1O[C@](C)(CCCC(C)C)[C@H]1CC3(CO[C@H]21)CN(C(=O)OC(C)(C)C)C3 |
| InChI | InChI=1S/C28H43NO5/c1-8-31-22-13-9-12-20-23-21(27(7,33-24(20)22)14-10-11-19(2)3)15-28(18-32-23)16-29(17-28)25(30)34-26(4,5)6/h9,12-13,19,21,23H,8,10-11,14-18H2,1-7H3/t21-,23+,27+/m0/s1 |
| InChIKey | MZHPQVDIFTXVOJ-VBANMALSSA-N |
| XLogP | 6.38 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.65 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |