C30H44N2O6 — CID 110144905
tert-butyl (1S,9S,10S,12S,17S)-9-methyl-6-[2-(methylamino)-2-oxoethoxy]-9-(4-methylpent-3-enyl)-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-triene-14-carboxylate (PubChem CID 110144905) has the molecular formula C30H44N2O6 and a molecular weight of 528.69 g/mol. Its IUPAC name is tert-butyl (1S,9S,10S,12S,17S)-9-methyl-6-[2-(methylamino)-2-oxoethoxy]-9-(4-methylpent-3-enyl)-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-triene-14-carboxylate.
| Compound Name | tert-butyl (1S,9S,10S,12S,17S)-9-methyl-6-[2-(methylamino)-2-oxoethoxy]-9-(4-methylpent-3-enyl)-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-triene-14-carboxylate |
|---|---|
| PubChem CID | 110144905 |
| Molecular Formula | C30H44N2O6 |
| Molecular Weight | 528.69 g/mol |
| Exact Mass | 528.32 |
| IUPAC Name | tert-butyl (1S,9S,10S,12S,17S)-9-methyl-6-[2-(methylamino)-2-oxoethoxy]-9-(4-methylpent-3-enyl)-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-triene-14-carboxylate |
| SMILES | CNC(=O)COc1cccc2c1O[C@@](C)(CCC=C(C)C)[C@H]1C[C@H]3CN(C(=O)OC(C)(C)C)CC[C@@H]3O[C@H]21 |
| InChI | InChI=1S/C30H44N2O6/c1-19(2)10-9-14-30(6)22-16-20-17-32(28(34)38-29(3,4)5)15-13-23(20)36-26(22)21-11-8-12-24(27(21)37-30)35-18-25(33)31-7/h8,10-12,20,22-23,26H,9,13-18H2,1-7H3,(H,31,33)/t20-,22-,23-,26+,30-/m0/s1 |
| InChIKey | WNFOCMIKCFXPAB-RRBJLIBJSA-N |
| XLogP | 5.41 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.69 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|