C33H49NO7 — CID 110145058
5-[(4aS,5S,10bS)-5-methyl-5-(4-methylpent-3-enyl)-1'-[(2-methylpropan-2-yl)oxycarbonyl]spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-7-yl]oxypentanoic acid (PubChem CID 110145058) has the molecular formula C33H49NO7 and a molecular weight of 571.76 g/mol. Its IUPAC name is 5-[(4aS,5S,10bS)-5-methyl-5-(4-methylpent-3-enyl)-1'-[(2-methylpropan-2-yl)oxycarbonyl]spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-7-yl]oxypentanoic acid.
| Compound Name | 5-[(4aS,5S,10bS)-5-methyl-5-(4-methylpent-3-enyl)-1'-[(2-methylpropan-2-yl)oxycarbonyl]spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-7-yl]oxypentanoic acid |
|---|---|
| PubChem CID | 110145058 |
| Molecular Formula | C33H49NO7 |
| Molecular Weight | 571.76 g/mol |
| Exact Mass | 571.35 |
| IUPAC Name | 5-[(4aS,5S,10bS)-5-methyl-5-(4-methylpent-3-enyl)-1'-[(2-methylpropan-2-yl)oxycarbonyl]spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-7-yl]oxypentanoic acid |
| SMILES | CC(C)=CCC[C@]1(C)Oc2c(OCCCCC(=O)O)cccc2[C@H]2OCC3(CCN(C(=O)OC(C)(C)C)CC3)C[C@@H]21 |
| InChI | InChI=1S/C33H49NO7/c1-23(2)11-10-15-32(6)25-21-33(16-18-34(19-17-33)30(37)41-31(3,4)5)22-39-28(25)24-12-9-13-26(29(24)40-32)38-20-8-7-14-27(35)36/h9,11-13,25,28H,7-8,10,14-22H2,1-6H3,(H,35,36)/t25-,28+,32-/m0/s1 |
| InChIKey | VBVHPCNITVCSLL-WLIAIIHGSA-N |
| XLogP | 7.31 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.76 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|