C32H47NO7 — CID 110145010
tert-butyl (1S,9R,10S,12S,17S)-5-(4-methoxy-4-oxobutoxy)-9-methyl-9-(4-methylpent-3-enyl)-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-triene-14-carboxylate (PubChem CID 110145010) has the molecular formula C32H47NO7 and a molecular weight of 557.73 g/mol. Its IUPAC name is tert-butyl (1S,9R,10S,12S,17S)-5-(4-methoxy-4-oxobutoxy)-9-methyl-9-(4-methylpent-3-enyl)-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-triene-14-carboxylate.
| Compound Name | tert-butyl (1S,9R,10S,12S,17S)-5-(4-methoxy-4-oxobutoxy)-9-methyl-9-(4-methylpent-3-enyl)-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-triene-14-carboxylate |
|---|---|
| PubChem CID | 110145010 |
| Molecular Formula | C32H47NO7 |
| Molecular Weight | 557.73 g/mol |
| Exact Mass | 557.34 |
| IUPAC Name | tert-butyl (1S,9R,10S,12S,17S)-5-(4-methoxy-4-oxobutoxy)-9-methyl-9-(4-methylpent-3-enyl)-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-triene-14-carboxylate |
| SMILES | COC(=O)CCCOc1ccc2c(c1)O[C@](C)(CCC=C(C)C)[C@H]1C[C@H]3CN(C(=O)OC(C)(C)C)CC[C@@H]3O[C@H]21 |
| InChI | InChI=1S/C32H47NO7/c1-21(2)10-8-15-32(6)25-18-22-20-33(30(35)40-31(3,4)5)16-14-26(22)38-29(25)24-13-12-23(19-27(24)39-32)37-17-9-11-28(34)36-7/h10,12-13,19,22,25-26,29H,8-9,11,14-18,20H2,1-7H3/t22-,25-,26-,29+,32+/m0/s1 |
| InChIKey | LAVYYIQFUDBNGH-SIUUOBTRSA-N |
| XLogP | 6.62 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.73 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|