C31H47NO7 — CID 110154038
tert-butyl (1S,9R,10S,12S,17S)-5-[2-(2-hydroxyethoxy)ethoxy]-9-methyl-9-(4-methylpent-3-enyl)-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-triene-14-carboxylate (PubChem CID 110154038) has the molecular formula C31H47NO7 and a molecular weight of 545.72 g/mol. Its IUPAC name is tert-butyl (1S,9R,10S,12S,17S)-5-[2-(2-hydroxyethoxy)ethoxy]-9-methyl-9-(4-methylpent-3-enyl)-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-triene-14-carboxylate.
| Compound Name | tert-butyl (1S,9R,10S,12S,17S)-5-[2-(2-hydroxyethoxy)ethoxy]-9-methyl-9-(4-methylpent-3-enyl)-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-triene-14-carboxylate |
|---|---|
| PubChem CID | 110154038 |
| Molecular Formula | C31H47NO7 |
| Molecular Weight | 545.72 g/mol |
| Exact Mass | 545.34 |
| IUPAC Name | tert-butyl (1S,9R,10S,12S,17S)-5-[2-(2-hydroxyethoxy)ethoxy]-9-methyl-9-(4-methylpent-3-enyl)-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-triene-14-carboxylate |
| SMILES | CC(C)=CCC[C@@]1(C)Oc2cc(OCCOCCO)ccc2[C@H]2O[C@H]3CCN(C(=O)OC(C)(C)C)C[C@@H]3C[C@@H]21 |
| InChI | InChI=1S/C31H47NO7/c1-21(2)8-7-12-31(6)25-18-22-20-32(29(34)39-30(3,4)5)13-11-26(22)37-28(25)24-10-9-23(19-27(24)38-31)36-17-16-35-15-14-33/h8-10,19,22,25-26,28,33H,7,11-18,20H2,1-6H3/t22-,25-,26-,28+,31+/m0/s1 |
| InChIKey | GICXNOLASWMMDH-UZUFEGSWSA-N |
| XLogP | 5.68 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.72 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|