C22H26N2O2 — CID 110143334
(4aS,10bS)-5,5-dimethyl-1'-(pyridin-2-ylmethyl)spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,3'-azetidine] (PubChem CID 110143334) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is (4aS,10bS)-5,5-dimethyl-1'-(pyridin-2-ylmethyl)spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,3'-azetidine].
| Compound Name | (4aS,10bS)-5,5-dimethyl-1'-(pyridin-2-ylmethyl)spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,3'-azetidine] |
|---|---|
| PubChem CID | 110143334 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | (4aS,10bS)-5,5-dimethyl-1'-(pyridin-2-ylmethyl)spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,3'-azetidine] |
| SMILES | CC1(C)Oc2ccccc2[C@H]2OCC3(C[C@@H]21)CN(Cc1ccccn1)C3 |
| InChI | InChI=1S/C22H26N2O2/c1-21(2)18-11-22(13-24(14-22)12-16-7-5-6-10-23-16)15-25-20(18)17-8-3-4-9-19(17)26-21/h3-10,18,20H,11-15H2,1-2H3/t18-,20+/m0/s1 |
| InChIKey | FMPQPMLRKGIBEA-AZUAARDMSA-N |
| XLogP | 3.83 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |