C25H34N4O3 — CID 110142709
5-[[(4aS,10bS)-7-methoxy-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl]methyl]-N-methylpyrimidin-2-amine (PubChem CID 110142709) has the molecular formula C25H34N4O3 and a molecular weight of 438.57 g/mol. Its IUPAC name is 5-[[(4aS,10bS)-7-methoxy-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl]methyl]-N-methylpyrimidin-2-amine.
| Compound Name | 5-[[(4aS,10bS)-7-methoxy-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl]methyl]-N-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 110142709 |
| Molecular Formula | C25H34N4O3 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | 5-[[(4aS,10bS)-7-methoxy-5,5-dimethylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-yl]methyl]-N-methylpyrimidin-2-amine |
| SMILES | CNc1ncc(CN2CCC3(CC2)CO[C@@H]2c4cccc(OC)c4OC(C)(C)[C@H]2C3)cn1 |
| InChI | InChI=1S/C25H34N4O3/c1-24(2)19-12-25(16-31-21(19)18-6-5-7-20(30-4)22(18)32-24)8-10-29(11-9-25)15-17-13-27-23(26-3)28-14-17/h5-7,13-14,19,21H,8-12,15-16H2,1-4H3,(H,26,27,28)/t19-,21+/m0/s1 |
| InChIKey | PVOYABJBNGUNEN-PZJWPPBQSA-N |
| XLogP | 4.06 |
| TPSA | 68.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |