C20H29NO2 — CID 110185891
3-cyclohexyl-1-(4-hydroxy-4-phenylpiperidin-1-yl)propan-1-one (PubChem CID 110185891) has the molecular formula C20H29NO2 and a molecular weight of 315.46 g/mol. Its IUPAC name is 3-cyclohexyl-1-(4-hydroxy-4-phenylpiperidin-1-yl)propan-1-one.
| Compound Name | 3-cyclohexyl-1-(4-hydroxy-4-phenylpiperidin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 110185891 |
| Molecular Formula | C20H29NO2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | 3-cyclohexyl-1-(4-hydroxy-4-phenylpiperidin-1-yl)propan-1-one |
| SMILES | O=C(CCC1CCCCC1)N1CCC(O)(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H29NO2/c22-19(12-11-17-7-3-1-4-8-17)21-15-13-20(23,14-16-21)18-9-5-2-6-10-18/h2,5-6,9-10,17,23H,1,3-4,7-8,11-16H2 |
| InChIKey | UCOKNHXBMJWRLI-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |