C19H29N3O2 — CID 97197401
1-(4-hydroxy-4-pyridin-3-ylpiperidin-1-yl)-3-[(3R)-1-methylpiperidin-3-yl]propan-1-one (PubChem CID 97197401) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is 1-(4-hydroxy-4-pyridin-3-ylpiperidin-1-yl)-3-[(3R)-1-methylpiperidin-3-yl]propan-1-one.
| Compound Name | 1-(4-hydroxy-4-pyridin-3-ylpiperidin-1-yl)-3-[(3R)-1-methylpiperidin-3-yl]propan-1-one |
|---|---|
| PubChem CID | 97197401 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | 1-(4-hydroxy-4-pyridin-3-ylpiperidin-1-yl)-3-[(3R)-1-methylpiperidin-3-yl]propan-1-one |
| SMILES | CN1CCC[C@H](CCC(=O)N2CCC(O)(c3cccnc3)CC2)C1 |
| InChI | InChI=1S/C19H29N3O2/c1-21-11-3-4-16(15-21)6-7-18(23)22-12-8-19(24,9-13-22)17-5-2-10-20-14-17/h2,5,10,14,16,24H,3-4,6-9,11-13,15H2,1H3/t16-/m1/s1 |
| InChIKey | LLWCJJGGZMRQNK-MRXNPFEDSA-N |
| XLogP | 2.01 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |