C18H26N4O3 — CID 95827555
1-[(3S)-3-(4-hydroxy-4-pyridin-3-ylpiperidine-1-carbonyl)-4-methylpiperazin-1-yl]ethanone (PubChem CID 95827555) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is 1-[(3S)-3-(4-hydroxy-4-pyridin-3-ylpiperidine-1-carbonyl)-4-methylpiperazin-1-yl]ethanone.
| Compound Name | 1-[(3S)-3-(4-hydroxy-4-pyridin-3-ylpiperidine-1-carbonyl)-4-methylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 95827555 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 1-[(3S)-3-(4-hydroxy-4-pyridin-3-ylpiperidine-1-carbonyl)-4-methylpiperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(C)[C@H](C(=O)N2CCC(O)(c3cccnc3)CC2)C1 |
| InChI | InChI=1S/C18H26N4O3/c1-14(23)22-11-10-20(2)16(13-22)17(24)21-8-5-18(25,6-9-21)15-4-3-7-19-12-15/h3-4,7,12,16,25H,5-6,8-11,13H2,1-2H3/t16-/m0/s1 |
| InChIKey | BALOXYQFSVZCAN-INIZCTEOSA-N |
| XLogP | 0.05 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |