C17H24N4O3 — CID 121497817
4-hydroxy-N-(1-methyl-6-oxopiperidin-3-yl)-4-pyridin-3-ylpiperidine-1-carboxamide (PubChem CID 121497817) has the molecular formula C17H24N4O3 and a molecular weight of 332.40 g/mol. Its IUPAC name is 4-hydroxy-N-(1-methyl-6-oxopiperidin-3-yl)-4-pyridin-3-ylpiperidine-1-carboxamide.
| Compound Name | 4-hydroxy-N-(1-methyl-6-oxopiperidin-3-yl)-4-pyridin-3-ylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 121497817 |
| Molecular Formula | C17H24N4O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 4-hydroxy-N-(1-methyl-6-oxopiperidin-3-yl)-4-pyridin-3-ylpiperidine-1-carboxamide |
| SMILES | CN1CC(NC(=O)N2CCC(O)(c3cccnc3)CC2)CCC1=O |
| InChI | InChI=1S/C17H24N4O3/c1-20-12-14(4-5-15(20)22)19-16(23)21-9-6-17(24,7-10-21)13-3-2-8-18-11-13/h2-3,8,11,14,24H,4-7,9-10,12H2,1H3,(H,19,23) |
| InChIKey | GLHUBMZWNOBQTC-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |