C16H17ClN4O2 — CID 72877334
N-(6-chloro-3-pyridinyl)-4-hydroxy-4-pyridin-3-ylpiperidine-1-carboxamide (PubChem CID 72877334) has the molecular formula C16H17ClN4O2 and a molecular weight of 332.79 g/mol. Its IUPAC name is N-(6-chloro-3-pyridinyl)-4-hydroxy-4-pyridin-3-ylpiperidine-1-carboxamide.
| Compound Name | N-(6-chloro-3-pyridinyl)-4-hydroxy-4-pyridin-3-ylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 72877334 |
| Molecular Formula | C16H17ClN4O2 |
| Molecular Weight | 332.79 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | N-(6-chloro-3-pyridinyl)-4-hydroxy-4-pyridin-3-ylpiperidine-1-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)nc1)N1CCC(O)(c2cccnc2)CC1 |
| InChI | InChI=1S/C16H17ClN4O2/c17-14-4-3-13(11-19-14)20-15(22)21-8-5-16(23,6-9-21)12-2-1-7-18-10-12/h1-4,7,10-11,23H,5-6,8-9H2,(H,20,22) |
| InChIKey | RSJNIXLVJVEZTG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.79 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|