C21H25ClN4O3 — CID 142110737
4-(3-chloro-2-pyridinyl)-N-[4-(4-hydroxyoxan-4-yl)phenyl]piperazine-1-carboxamide (PubChem CID 142110737) has the molecular formula C21H25ClN4O3 and a molecular weight of 416.91 g/mol. Its IUPAC name is 4-(3-chloro-2-pyridinyl)-N-[4-(4-hydroxyoxan-4-yl)phenyl]piperazine-1-carboxamide.
| Compound Name | 4-(3-chloro-2-pyridinyl)-N-[4-(4-hydroxyoxan-4-yl)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 142110737 |
| Molecular Formula | C21H25ClN4O3 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 4-(3-chloro-2-pyridinyl)-N-[4-(4-hydroxyoxan-4-yl)phenyl]piperazine-1-carboxamide |
| SMILES | O=C(Nc1ccc(C2(O)CCOCC2)cc1)N1CCN(c2ncccc2Cl)CC1 |
| InChI | InChI=1S/C21H25ClN4O3/c22-18-2-1-9-23-19(18)25-10-12-26(13-11-25)20(27)24-17-5-3-16(4-6-17)21(28)7-14-29-15-8-21/h1-6,9,28H,7-8,10-15H2,(H,24,27) |
| InChIKey | VQIDMDMVKVVRKR-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 77.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |