C17H17ClN4O3 — CID 110397197
2-[4-[(3-chlorophenyl)carbamoyl]piperazin-1-yl]pyridine-3-carboxylic acid (PubChem CID 110397197) has the molecular formula C17H17ClN4O3 and a molecular weight of 360.80 g/mol. Its IUPAC name is 2-[4-[(3-chlorophenyl)carbamoyl]piperazin-1-yl]pyridine-3-carboxylic acid.
| Compound Name | 2-[4-[(3-chlorophenyl)carbamoyl]piperazin-1-yl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 110397197 |
| Molecular Formula | C17H17ClN4O3 |
| Molecular Weight | 360.80 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 2-[4-[(3-chlorophenyl)carbamoyl]piperazin-1-yl]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cccnc1N1CCN(C(=O)Nc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C17H17ClN4O3/c18-12-3-1-4-13(11-12)20-17(25)22-9-7-21(8-10-22)15-14(16(23)24)5-2-6-19-15/h1-6,11H,7-10H2,(H,20,25)(H,23,24) |
| InChIKey | AQCLJVWODSNWQO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.80 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |