C20H25ClN6O — CID 122334555
N-(3-chlorophenyl)-4-(6-piperidin-1-ylpyridazin-3-yl)piperazine-1-carboxamide (PubChem CID 122334555) has the molecular formula C20H25ClN6O and a molecular weight of 400.91 g/mol. Its IUPAC name is N-(3-chlorophenyl)-4-(6-piperidin-1-ylpyridazin-3-yl)piperazine-1-carboxamide.
| Compound Name | N-(3-chlorophenyl)-4-(6-piperidin-1-ylpyridazin-3-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 122334555 |
| Molecular Formula | C20H25ClN6O |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | N-(3-chlorophenyl)-4-(6-piperidin-1-ylpyridazin-3-yl)piperazine-1-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1)N1CCN(c2ccc(N3CCCCC3)nn2)CC1 |
| InChI | InChI=1S/C20H25ClN6O/c21-16-5-4-6-17(15-16)22-20(28)27-13-11-26(12-14-27)19-8-7-18(23-24-19)25-9-2-1-3-10-25/h4-8,15H,1-3,9-14H2,(H,22,28) |
| InChIKey | AOOASXOLTRINJR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |