C21H29NO3 — CID 45338210
1-(3-cyclohexylpropanoyl)-4-phenylpiperidine-4-carboxylic acid (PubChem CID 45338210) has the molecular formula C21H29NO3 and a molecular weight of 343.47 g/mol. Its IUPAC name is 1-(3-cyclohexylpropanoyl)-4-phenylpiperidine-4-carboxylic acid.
| Compound Name | 1-(3-cyclohexylpropanoyl)-4-phenylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 45338210 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | 1-(3-cyclohexylpropanoyl)-4-phenylpiperidine-4-carboxylic acid |
| SMILES | O=C(CCC1CCCCC1)N1CCC(C(=O)O)(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H29NO3/c23-19(12-11-17-7-3-1-4-8-17)22-15-13-21(14-16-22,20(24)25)18-9-5-2-6-10-18/h2,5-6,9-10,17H,1,3-4,7-8,11-16H2,(H,24,25) |
| InChIKey | QPQMFJNQBWSBEJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |