C40H50N2O4 — CID 139311989
4-[(8aS)-2-[1-(3-cyclohexylpropanoyl)-4-phenylpiperidine-4-carbonyl]-5,5,8a-trimethyl-3,8-dihydro-1H-isoquinolin-6-yl]benzoic acid (PubChem CID 139311989) has the molecular formula C40H50N2O4 and a molecular weight of 622.85 g/mol. Its IUPAC name is 4-[(8aS)-2-[1-(3-cyclohexylpropanoyl)-4-phenylpiperidine-4-carbonyl]-5,5,8a-trimethyl-3,8-dihydro-1H-isoquinolin-6-yl]benzoic acid.
| Compound Name | 4-[(8aS)-2-[1-(3-cyclohexylpropanoyl)-4-phenylpiperidine-4-carbonyl]-5,5,8a-trimethyl-3,8-dihydro-1H-isoquinolin-6-yl]benzoic acid |
|---|---|
| PubChem CID | 139311989 |
| Molecular Formula | C40H50N2O4 |
| Molecular Weight | 622.85 g/mol |
| Exact Mass | 622.38 |
| IUPAC Name | 4-[(8aS)-2-[1-(3-cyclohexylpropanoyl)-4-phenylpiperidine-4-carbonyl]-5,5,8a-trimethyl-3,8-dihydro-1H-isoquinolin-6-yl]benzoic acid |
| SMILES | CC1(C)C(c2ccc(C(=O)O)cc2)=CC[C@]2(C)CN(C(=O)C3(c4ccccc4)CCN(C(=O)CCC4CCCCC4)CC3)CC=C12 |
| InChI | InChI=1S/C40H50N2O4/c1-38(2)33(30-15-17-31(18-16-30)36(44)45)20-22-39(3)28-42(25-21-34(38)39)37(46)40(32-12-8-5-9-13-32)23-26-41(27-24-40)35(43)19-14-29-10-6-4-7-11-29/h5,8-9,12-13,15-18,20-21,29H,4,6-7,10-11,14,19,22-28H2,1-3H3,(H,44,45)/t39-/m1/s1 |
| InChIKey | IIRHTFZHVVKLTA-LDLOPFEMSA-N |
| XLogP | 7.89 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.85 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|