C20H26ClNO4S — CID 154978119
tert-butyl 8-chlorospiro[2,4,4a,10b-tetrahydropyrano[3,2-c][1,2]benzoxathiine-3,4'-piperidine]-1'-carboxylate (PubChem CID 154978119) has the molecular formula C20H26ClNO4S and a molecular weight of 411.95 g/mol. Its IUPAC name is tert-butyl 8-chlorospiro[2,4,4a,10b-tetrahydropyrano[3,2-c][1,2]benzoxathiine-3,4'-piperidine]-1'-carboxylate.
| Compound Name | tert-butyl 8-chlorospiro[2,4,4a,10b-tetrahydropyrano[3,2-c][1,2]benzoxathiine-3,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 154978119 |
| Molecular Formula | C20H26ClNO4S |
| Molecular Weight | 411.95 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | tert-butyl 8-chlorospiro[2,4,4a,10b-tetrahydropyrano[3,2-c][1,2]benzoxathiine-3,4'-piperidine]-1'-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)COC1c3ccc(Cl)cc3OSC1C2 |
| InChI | InChI=1S/C20H26ClNO4S/c1-19(2,3)25-18(23)22-8-6-20(7-9-22)11-16-17(24-12-20)14-5-4-13(21)10-15(14)26-27-16/h4-5,10,16-17H,6-9,11-12H2,1-3H3 |
| InChIKey | NPWHGERODKKASE-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.95 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|