C18H23ClN2O3 — CID 169137990
tert-butyl 5-chloro-1-methanimidoylspiro[1H-2-benzofuran-3,4'-piperidine]-1'-carboxylate (PubChem CID 169137990) has the molecular formula C18H23ClN2O3 and a molecular weight of 350.85 g/mol. Its IUPAC name is tert-butyl 5-chloro-1-methanimidoylspiro[1H-2-benzofuran-3,4'-piperidine]-1'-carboxylate.
| Compound Name | tert-butyl 5-chloro-1-methanimidoylspiro[1H-2-benzofuran-3,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 169137990 |
| Molecular Formula | C18H23ClN2O3 |
| Molecular Weight | 350.85 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | tert-butyl 5-chloro-1-methanimidoylspiro[1H-2-benzofuran-3,4'-piperidine]-1'-carboxylate |
| SMILES | [H]/N=C/C1OC2(CCN(C(=O)OC(C)(C)C)CC2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C18H23ClN2O3/c1-17(2,3)24-16(22)21-8-6-18(7-9-21)14-10-12(19)4-5-13(14)15(11-20)23-18/h4-5,10-11,15,20H,6-9H2,1-3H3/b20-11+ |
| InChIKey | CHDBBEIDLDBDMV-RGVLZGJSSA-N |
| XLogP | 4.29 |
| TPSA | 62.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.85 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|