C24H28O4 — CID 175660101
(2S,3R,4aS,10bS)-2-ethyl-5,5-dimethyl-3-(4-methylphenyl)-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-9-carboxylic acid (PubChem CID 175660101) has the molecular formula C24H28O4 and a molecular weight of 380.48 g/mol. Its IUPAC name is (2S,3R,4aS,10bS)-2-ethyl-5,5-dimethyl-3-(4-methylphenyl)-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-9-carboxylic acid.
| Compound Name | (2S,3R,4aS,10bS)-2-ethyl-5,5-dimethyl-3-(4-methylphenyl)-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-9-carboxylic acid |
|---|---|
| PubChem CID | 175660101 |
| Molecular Formula | C24H28O4 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | (2S,3R,4aS,10bS)-2-ethyl-5,5-dimethyl-3-(4-methylphenyl)-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-9-carboxylic acid |
| SMILES | CC[C@@H]1O[C@@H]2c3cc(C(=O)O)ccc3OC(C)(C)[C@H]2C[C@@H]1c1ccc(C)cc1 |
| InChI | InChI=1S/C24H28O4/c1-5-20-17(15-8-6-14(2)7-9-15)13-19-22(27-20)18-12-16(23(25)26)10-11-21(18)28-24(19,3)4/h6-12,17,19-20,22H,5,13H2,1-4H3,(H,25,26)/t17-,19+,20+,22-/m1/s1 |
| InChIKey | GLSJZCBQMLCNND-IWLVTHKOSA-N |
| XLogP | 5.50 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |