C23H25ClO4 — CID 110161768
(2R,3R,4aS,10bS)-3-(3-chlorophenyl)-2-ethyl-5,5-dimethyl-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-9-carboxylic acid (PubChem CID 110161768) has the molecular formula C23H25ClO4 and a molecular weight of 400.90 g/mol. Its IUPAC name is (2R,3R,4aS,10bS)-3-(3-chlorophenyl)-2-ethyl-5,5-dimethyl-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-9-carboxylic acid.
| Compound Name | (2R,3R,4aS,10bS)-3-(3-chlorophenyl)-2-ethyl-5,5-dimethyl-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-9-carboxylic acid |
|---|---|
| PubChem CID | 110161768 |
| Molecular Formula | C23H25ClO4 |
| Molecular Weight | 400.90 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | (2R,3R,4aS,10bS)-3-(3-chlorophenyl)-2-ethyl-5,5-dimethyl-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-9-carboxylic acid |
| SMILES | CC[C@H]1O[C@@H]2c3cc(C(=O)O)ccc3OC(C)(C)[C@H]2C[C@@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C23H25ClO4/c1-4-19-16(13-6-5-7-15(24)10-13)12-18-21(27-19)17-11-14(22(25)26)8-9-20(17)28-23(18,2)3/h5-11,16,18-19,21H,4,12H2,1-3H3,(H,25,26)/t16-,18+,19-,21-/m1/s1 |
| InChIKey | MGAXRHAXIMJNKI-WQZMEWCLSA-N |
| XLogP | 5.85 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.90 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |