C33H37ClO4 — CID 155988986
2-[2-[(2S,3R,5R,6S)-5-(3-chlorophenyl)-6-ethyl-3-prop-1-en-2-yloxan-2-yl]-4-(2-phenylpropan-2-yl)phenoxy]acetic acid (PubChem CID 155988986) has the molecular formula C33H37ClO4 and a molecular weight of 533.11 g/mol. Its IUPAC name is 2-[2-[(2S,3R,5R,6S)-5-(3-chlorophenyl)-6-ethyl-3-prop-1-en-2-yloxan-2-yl]-4-(2-phenylpropan-2-yl)phenoxy]acetic acid.
| Compound Name | 2-[2-[(2S,3R,5R,6S)-5-(3-chlorophenyl)-6-ethyl-3-prop-1-en-2-yloxan-2-yl]-4-(2-phenylpropan-2-yl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 155988986 |
| Molecular Formula | C33H37ClO4 |
| Molecular Weight | 533.11 g/mol |
| Exact Mass | 532.24 |
| IUPAC Name | 2-[2-[(2S,3R,5R,6S)-5-(3-chlorophenyl)-6-ethyl-3-prop-1-en-2-yloxan-2-yl]-4-(2-phenylpropan-2-yl)phenoxy]acetic acid |
| SMILES | C=C(C)[C@H]1C[C@H](c2cccc(Cl)c2)[C@H](CC)O[C@@H]1c1cc(C(C)(C)c2ccccc2)ccc1OCC(=O)O |
| InChI | InChI=1S/C33H37ClO4/c1-6-29-27(22-11-10-14-25(34)17-22)19-26(21(2)3)32(38-29)28-18-24(15-16-30(28)37-20-31(35)36)33(4,5)23-12-8-7-9-13-23/h7-18,26-27,29,32H,2,6,19-20H2,1,3-5H3,(H,35,36)/t26-,27-,29+,32+/m1/s1 |
| InChIKey | KLPCALYBACXDTJ-GISMLAESSA-N |
| XLogP | 8.35 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.11 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|