C34H31ClO5 — CID 155988806
2-[2-[(2S,3R,5R,6R)-5-(4-chlorophenyl)-6-phenyl-3-prop-1-en-2-yloxan-2-yl]-4-phenoxyphenoxy]acetic acid (PubChem CID 155988806) has the molecular formula C34H31ClO5 and a molecular weight of 555.07 g/mol. Its IUPAC name is 2-[2-[(2S,3R,5R,6R)-5-(4-chlorophenyl)-6-phenyl-3-prop-1-en-2-yloxan-2-yl]-4-phenoxyphenoxy]acetic acid.
| Compound Name | 2-[2-[(2S,3R,5R,6R)-5-(4-chlorophenyl)-6-phenyl-3-prop-1-en-2-yloxan-2-yl]-4-phenoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 155988806 |
| Molecular Formula | C34H31ClO5 |
| Molecular Weight | 555.07 g/mol |
| Exact Mass | 554.19 |
| IUPAC Name | 2-[2-[(2S,3R,5R,6R)-5-(4-chlorophenyl)-6-phenyl-3-prop-1-en-2-yloxan-2-yl]-4-phenoxyphenoxy]acetic acid |
| SMILES | C=C(C)[C@H]1C[C@H](c2ccc(Cl)cc2)[C@H](c2ccccc2)O[C@@H]1c1cc(Oc2ccccc2)ccc1OCC(=O)O |
| InChI | InChI=1S/C34H31ClO5/c1-22(2)28-20-29(23-13-15-25(35)16-14-23)33(24-9-5-3-6-10-24)40-34(28)30-19-27(39-26-11-7-4-8-12-26)17-18-31(30)38-21-32(36)37/h3-19,28-29,33-34H,1,20-21H2,2H3,(H,36,37)/t28-,29-,33+,34+/m1/s1 |
| InChIKey | NWAYWVGYWWCEEN-LBEJOGNCSA-N |
| XLogP | 8.77 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.07 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|