C29H28Cl2O5 — CID 155988902
2-[2-chloro-6-[(2S,3R,5R,6R)-6-(4-chlorophenyl)-5-phenyl-3-prop-1-en-2-yloxan-2-yl]-4-methoxyphenoxy]acetic acid (PubChem CID 155988902) has the molecular formula C29H28Cl2O5 and a molecular weight of 527.44 g/mol. Its IUPAC name is 2-[2-chloro-6-[(2S,3R,5R,6R)-6-(4-chlorophenyl)-5-phenyl-3-prop-1-en-2-yloxan-2-yl]-4-methoxyphenoxy]acetic acid.
| Compound Name | 2-[2-chloro-6-[(2S,3R,5R,6R)-6-(4-chlorophenyl)-5-phenyl-3-prop-1-en-2-yloxan-2-yl]-4-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 155988902 |
| Molecular Formula | C29H28Cl2O5 |
| Molecular Weight | 527.44 g/mol |
| Exact Mass | 526.13 |
| IUPAC Name | 2-[2-chloro-6-[(2S,3R,5R,6R)-6-(4-chlorophenyl)-5-phenyl-3-prop-1-en-2-yloxan-2-yl]-4-methoxyphenoxy]acetic acid |
| SMILES | C=C(C)[C@H]1C[C@H](c2ccccc2)[C@H](c2ccc(Cl)cc2)O[C@@H]1c1cc(OC)cc(Cl)c1OCC(=O)O |
| InChI | InChI=1S/C29H28Cl2O5/c1-17(2)22-15-23(18-7-5-4-6-8-18)27(19-9-11-20(30)12-10-19)36-28(22)24-13-21(34-3)14-25(31)29(24)35-16-26(32)33/h4-14,22-23,27-28H,1,15-16H2,2-3H3,(H,32,33)/t22-,23-,27+,28+/m1/s1 |
| InChIKey | CEVWAMCIZCMBPT-IJEQNIMCSA-N |
| XLogP | 7.64 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.44 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|