C36H34Cl2O5 — CID 175659594
2-[5-[2-(4-chlorophenyl)ethoxy]-2-[(2S,3R,5R,6R)-6-(3-chlorophenyl)-5-phenyl-3-prop-1-en-2-yloxan-2-yl]phenoxy]acetic acid (PubChem CID 175659594) has the molecular formula C36H34Cl2O5 and a molecular weight of 617.57 g/mol. Its IUPAC name is 2-[5-[2-(4-chlorophenyl)ethoxy]-2-[(2S,3R,5R,6R)-6-(3-chlorophenyl)-5-phenyl-3-prop-1-en-2-yloxan-2-yl]phenoxy]acetic acid.
| Compound Name | 2-[5-[2-(4-chlorophenyl)ethoxy]-2-[(2S,3R,5R,6R)-6-(3-chlorophenyl)-5-phenyl-3-prop-1-en-2-yloxan-2-yl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 175659594 |
| Molecular Formula | C36H34Cl2O5 |
| Molecular Weight | 617.57 g/mol |
| Exact Mass | 616.18 |
| IUPAC Name | 2-[5-[2-(4-chlorophenyl)ethoxy]-2-[(2S,3R,5R,6R)-6-(3-chlorophenyl)-5-phenyl-3-prop-1-en-2-yloxan-2-yl]phenoxy]acetic acid |
| SMILES | C=C(C)[C@H]1C[C@H](c2ccccc2)[C@H](c2cccc(Cl)c2)O[C@@H]1c1ccc(OCCc2ccc(Cl)cc2)cc1OCC(=O)O |
| InChI | InChI=1S/C36H34Cl2O5/c1-23(2)31-21-32(25-7-4-3-5-8-25)35(26-9-6-10-28(38)19-26)43-36(31)30-16-15-29(20-33(30)42-22-34(39)40)41-18-17-24-11-13-27(37)14-12-24/h3-16,19-20,31-32,35-36H,1,17-18,21-22H2,2H3,(H,39,40)/t31-,32-,35+,36-/m1/s1 |
| InChIKey | DIEWWPLSBLZRRQ-LSJGKSCGSA-N |
| XLogP | 9.26 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.57 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|