C28H24BrClF2O4 — CID 155989326
2-[6-bromo-2-[(2S,3R,5R,6R)-5-(3-chlorophenyl)-6-(3-fluorophenyl)-3-prop-1-en-2-yloxan-2-yl]-3-fluorophenoxy]acetic acid (PubChem CID 155989326) has the molecular formula C28H24BrClF2O4 and a molecular weight of 577.85 g/mol. Its IUPAC name is 2-[6-bromo-2-[(2S,3R,5R,6R)-5-(3-chlorophenyl)-6-(3-fluorophenyl)-3-prop-1-en-2-yloxan-2-yl]-3-fluorophenoxy]acetic acid.
| Compound Name | 2-[6-bromo-2-[(2S,3R,5R,6R)-5-(3-chlorophenyl)-6-(3-fluorophenyl)-3-prop-1-en-2-yloxan-2-yl]-3-fluorophenoxy]acetic acid |
|---|---|
| PubChem CID | 155989326 |
| Molecular Formula | C28H24BrClF2O4 |
| Molecular Weight | 577.85 g/mol |
| Exact Mass | 576.05 |
| IUPAC Name | 2-[6-bromo-2-[(2S,3R,5R,6R)-5-(3-chlorophenyl)-6-(3-fluorophenyl)-3-prop-1-en-2-yloxan-2-yl]-3-fluorophenoxy]acetic acid |
| SMILES | C=C(C)[C@H]1C[C@H](c2cccc(Cl)c2)[C@H](c2cccc(F)c2)O[C@@H]1c1c(F)ccc(Br)c1OCC(=O)O |
| InChI | InChI=1S/C28H24BrClF2O4/c1-15(2)20-13-21(16-5-3-7-18(30)11-16)26(17-6-4-8-19(31)12-17)36-27(20)25-23(32)10-9-22(29)28(25)35-14-24(33)34/h3-12,20-21,26-27H,1,13-14H2,2H3,(H,33,34)/t20-,21-,26+,27+/m1/s1 |
| InChIKey | XKLJOJGEORNGBI-UXUXNBJMSA-N |
| XLogP | 8.02 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.85 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|