C32H35ClO4 — CID 175657586
2-[2-[(2R,3S,5S,6R)-6-benzyl-5-(3-chlorophenyl)-3-prop-1-en-2-yloxan-2-yl]-3,5,6-trimethylphenoxy]acetic acid (PubChem CID 175657586) has the molecular formula C32H35ClO4 and a molecular weight of 519.08 g/mol. Its IUPAC name is 2-[2-[(2R,3S,5S,6R)-6-benzyl-5-(3-chlorophenyl)-3-prop-1-en-2-yloxan-2-yl]-3,5,6-trimethylphenoxy]acetic acid.
| Compound Name | 2-[2-[(2R,3S,5S,6R)-6-benzyl-5-(3-chlorophenyl)-3-prop-1-en-2-yloxan-2-yl]-3,5,6-trimethylphenoxy]acetic acid |
|---|---|
| PubChem CID | 175657586 |
| Molecular Formula | C32H35ClO4 |
| Molecular Weight | 519.08 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | 2-[2-[(2R,3S,5S,6R)-6-benzyl-5-(3-chlorophenyl)-3-prop-1-en-2-yloxan-2-yl]-3,5,6-trimethylphenoxy]acetic acid |
| SMILES | C=C(C)[C@@H]1C[C@@H](c2cccc(Cl)c2)[C@@H](Cc2ccccc2)O[C@H]1c1c(C)cc(C)c(C)c1OCC(=O)O |
| InChI | InChI=1S/C32H35ClO4/c1-19(2)26-17-27(24-12-9-13-25(33)16-24)28(15-23-10-7-6-8-11-23)37-32(26)30-21(4)14-20(3)22(5)31(30)36-18-29(34)35/h6-14,16,26-28,32H,1,15,17-18H2,2-5H3,(H,34,35)/t26-,27-,28+,32+/m0/s1 |
| InChIKey | CBLACUYFHZWEHS-NAQGONTDSA-N |
| XLogP | 7.78 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.08 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|