C35H42O4 — CID 175656911
2-[2-[(2R,3S,5S,6R)-6-butyl-5-(4-phenylphenyl)-3-prop-1-en-2-yloxan-2-yl]-3,5,6-trimethylphenoxy]acetic acid (PubChem CID 175656911) has the molecular formula C35H42O4 and a molecular weight of 526.72 g/mol. Its IUPAC name is 2-[2-[(2R,3S,5S,6R)-6-butyl-5-(4-phenylphenyl)-3-prop-1-en-2-yloxan-2-yl]-3,5,6-trimethylphenoxy]acetic acid.
| Compound Name | 2-[2-[(2R,3S,5S,6R)-6-butyl-5-(4-phenylphenyl)-3-prop-1-en-2-yloxan-2-yl]-3,5,6-trimethylphenoxy]acetic acid |
|---|---|
| PubChem CID | 175656911 |
| Molecular Formula | C35H42O4 |
| Molecular Weight | 526.72 g/mol |
| Exact Mass | 526.31 |
| IUPAC Name | 2-[2-[(2R,3S,5S,6R)-6-butyl-5-(4-phenylphenyl)-3-prop-1-en-2-yloxan-2-yl]-3,5,6-trimethylphenoxy]acetic acid |
| SMILES | C=C(C)[C@@H]1C[C@@H](c2ccc(-c3ccccc3)cc2)[C@@H](CCCC)O[C@H]1c1c(C)cc(C)c(C)c1OCC(=O)O |
| InChI | InChI=1S/C35H42O4/c1-7-8-14-31-30(28-17-15-27(16-18-28)26-12-10-9-11-13-26)20-29(22(2)3)35(39-31)33-24(5)19-23(4)25(6)34(33)38-21-32(36)37/h9-13,15-19,29-31,35H,2,7-8,14,20-21H2,1,3-6H3,(H,36,37)/t29-,30-,31+,35+/m0/s1 |
| InChIKey | MVSHGSXDNPCYPZ-KVOHOPFUSA-N |
| XLogP | 8.74 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.72 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|