C41H46O5 — CID 175656816
2-[2-[(2R,3S,5S,6R)-6-butyl-5-(4-phenylphenyl)-3-prop-1-en-2-yloxan-2-yl]-4-(2,3,5-trimethylphenoxy)phenoxy]acetic acid (PubChem CID 175656816) has the molecular formula C41H46O5 and a molecular weight of 618.81 g/mol. Its IUPAC name is 2-[2-[(2R,3S,5S,6R)-6-butyl-5-(4-phenylphenyl)-3-prop-1-en-2-yloxan-2-yl]-4-(2,3,5-trimethylphenoxy)phenoxy]acetic acid.
| Compound Name | 2-[2-[(2R,3S,5S,6R)-6-butyl-5-(4-phenylphenyl)-3-prop-1-en-2-yloxan-2-yl]-4-(2,3,5-trimethylphenoxy)phenoxy]acetic acid |
|---|---|
| PubChem CID | 175656816 |
| Molecular Formula | C41H46O5 |
| Molecular Weight | 618.81 g/mol |
| Exact Mass | 618.33 |
| IUPAC Name | 2-[2-[(2R,3S,5S,6R)-6-butyl-5-(4-phenylphenyl)-3-prop-1-en-2-yloxan-2-yl]-4-(2,3,5-trimethylphenoxy)phenoxy]acetic acid |
| SMILES | C=C(C)[C@@H]1C[C@@H](c2ccc(-c3ccccc3)cc2)[C@@H](CCCC)O[C@H]1c1cc(Oc2cc(C)cc(C)c2C)ccc1OCC(=O)O |
| InChI | InChI=1S/C41H46O5/c1-7-8-14-38-35(32-17-15-31(16-18-32)30-12-10-9-11-13-30)24-34(26(2)3)41(46-38)36-23-33(19-20-37(36)44-25-40(42)43)45-39-22-27(4)21-28(5)29(39)6/h9-13,15-23,34-35,38,41H,2,7-8,14,24-25H2,1,3-6H3,(H,42,43)/t34-,35-,38+,41+/m0/s1 |
| InChIKey | FJRPFQRXVNVLSM-AAUMAZCNSA-N |
| XLogP | 10.53 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.81 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|