C32H35ClO5 — CID 175657563
2-[2-[(2R,3S,5S,6R)-5-(4-chlorophenyl)-6-methyl-3-prop-1-en-2-yloxan-2-yl]-4-(2,3,5-trimethylphenoxy)phenoxy]acetic acid (PubChem CID 175657563) has the molecular formula C32H35ClO5 and a molecular weight of 535.08 g/mol. Its IUPAC name is 2-[2-[(2R,3S,5S,6R)-5-(4-chlorophenyl)-6-methyl-3-prop-1-en-2-yloxan-2-yl]-4-(2,3,5-trimethylphenoxy)phenoxy]acetic acid.
| Compound Name | 2-[2-[(2R,3S,5S,6R)-5-(4-chlorophenyl)-6-methyl-3-prop-1-en-2-yloxan-2-yl]-4-(2,3,5-trimethylphenoxy)phenoxy]acetic acid |
|---|---|
| PubChem CID | 175657563 |
| Molecular Formula | C32H35ClO5 |
| Molecular Weight | 535.08 g/mol |
| Exact Mass | 534.22 |
| IUPAC Name | 2-[2-[(2R,3S,5S,6R)-5-(4-chlorophenyl)-6-methyl-3-prop-1-en-2-yloxan-2-yl]-4-(2,3,5-trimethylphenoxy)phenoxy]acetic acid |
| SMILES | C=C(C)[C@@H]1C[C@@H](c2ccc(Cl)cc2)[C@@H](C)O[C@H]1c1cc(Oc2cc(C)cc(C)c2C)ccc1OCC(=O)O |
| InChI | InChI=1S/C32H35ClO5/c1-18(2)26-16-27(23-7-9-24(33)10-8-23)22(6)37-32(26)28-15-25(11-12-29(28)36-17-31(34)35)38-30-14-19(3)13-20(4)21(30)5/h7-15,22,26-27,32H,1,16-17H2,2-6H3,(H,34,35)/t22-,26+,27-,32-/m1/s1 |
| InChIKey | NRWDSOKODPWFJO-JFEZTOQFSA-N |
| XLogP | 8.35 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.08 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|