C40H41Cl3O6 — CID 175655428
2-[4-(4-chloro-3,5-dimethylphenoxy)-2-[(2R,3S,5S,6R)-6-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]-5-(4-chlorophenyl)-3-prop-1-en-2-yloxan-2-yl]phenoxy]acetic acid (PubChem CID 175655428) has the molecular formula C40H41Cl3O6 and a molecular weight of 724.12 g/mol. Its IUPAC name is 2-[4-(4-chloro-3,5-dimethylphenoxy)-2-[(2R,3S,5S,6R)-6-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]-5-(4-chlorophenyl)-3-prop-1-en-2-yloxan-2-yl]phenoxy]acetic acid.
| Compound Name | 2-[4-(4-chloro-3,5-dimethylphenoxy)-2-[(2R,3S,5S,6R)-6-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]-5-(4-chlorophenyl)-3-prop-1-en-2-yloxan-2-yl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 175655428 |
| Molecular Formula | C40H41Cl3O6 |
| Molecular Weight | 724.12 g/mol |
| Exact Mass | 722.20 |
| IUPAC Name | 2-[4-(4-chloro-3,5-dimethylphenoxy)-2-[(2R,3S,5S,6R)-6-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]-5-(4-chlorophenyl)-3-prop-1-en-2-yloxan-2-yl]phenoxy]acetic acid |
| SMILES | C=C(C)[C@@H]1C[C@@H](c2ccc(Cl)cc2)[C@@H](CCOc2cc(C)c(Cl)c(C)c2)O[C@H]1c1cc(Oc2cc(C)c(Cl)c(C)c2)ccc1OCC(=O)O |
| InChI | InChI=1S/C40H41Cl3O6/c1-22(2)32-20-33(27-7-9-28(41)10-8-27)36(13-14-46-30-15-23(3)38(42)24(4)16-30)49-40(32)34-19-29(11-12-35(34)47-21-37(44)45)48-31-17-25(5)39(43)26(6)18-31/h7-12,15-19,32-33,36,40H,1,13-14,20-21H2,2-6H3,(H,44,45)/t32-,33-,36+,40+/m0/s1 |
| InChIKey | POUNWEHNFSRLPP-VMZCFSESSA-N |
| XLogP | 11.41 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.12 |
| LogP ≤ 5 | 11.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|