C34H30ClFO5 — CID 175661322
2-[2-[(2S,3R,5R,6R)-5-(2-chlorophenyl)-6-(4-fluorophenyl)-3-prop-1-en-2-yloxan-2-yl]-4-phenoxyphenoxy]acetic acid (PubChem CID 175661322) has the molecular formula C34H30ClFO5 and a molecular weight of 573.06 g/mol. Its IUPAC name is 2-[2-[(2S,3R,5R,6R)-5-(2-chlorophenyl)-6-(4-fluorophenyl)-3-prop-1-en-2-yloxan-2-yl]-4-phenoxyphenoxy]acetic acid.
| Compound Name | 2-[2-[(2S,3R,5R,6R)-5-(2-chlorophenyl)-6-(4-fluorophenyl)-3-prop-1-en-2-yloxan-2-yl]-4-phenoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 175661322 |
| Molecular Formula | C34H30ClFO5 |
| Molecular Weight | 573.06 g/mol |
| Exact Mass | 572.18 |
| IUPAC Name | 2-[2-[(2S,3R,5R,6R)-5-(2-chlorophenyl)-6-(4-fluorophenyl)-3-prop-1-en-2-yloxan-2-yl]-4-phenoxyphenoxy]acetic acid |
| SMILES | C=C(C)[C@H]1C[C@H](c2ccccc2Cl)[C@H](c2ccc(F)cc2)O[C@@H]1c1cc(Oc2ccccc2)ccc1OCC(=O)O |
| InChI | InChI=1S/C34H30ClFO5/c1-21(2)27-19-28(26-10-6-7-11-30(26)35)33(22-12-14-23(36)15-13-22)41-34(27)29-18-25(40-24-8-4-3-5-9-24)16-17-31(29)39-20-32(37)38/h3-18,27-28,33-34H,1,19-20H2,2H3,(H,37,38)/t27-,28-,33+,34+/m1/s1 |
| InChIKey | OGMFJZHFKLHJJG-RJNBBFARSA-N |
| XLogP | 8.91 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.06 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|