C37H37ClO4 — CID 155988909
2-[2-[(2S,3R,5R,6R)-6-(4-chlorophenyl)-5-phenyl-3-prop-1-en-2-yloxan-2-yl]-4-(2-phenylpropan-2-yl)phenoxy]acetic acid (PubChem CID 155988909) has the molecular formula C37H37ClO4 and a molecular weight of 581.15 g/mol. Its IUPAC name is 2-[2-[(2S,3R,5R,6R)-6-(4-chlorophenyl)-5-phenyl-3-prop-1-en-2-yloxan-2-yl]-4-(2-phenylpropan-2-yl)phenoxy]acetic acid.
| Compound Name | 2-[2-[(2S,3R,5R,6R)-6-(4-chlorophenyl)-5-phenyl-3-prop-1-en-2-yloxan-2-yl]-4-(2-phenylpropan-2-yl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 155988909 |
| Molecular Formula | C37H37ClO4 |
| Molecular Weight | 581.15 g/mol |
| Exact Mass | 580.24 |
| IUPAC Name | 2-[2-[(2S,3R,5R,6R)-6-(4-chlorophenyl)-5-phenyl-3-prop-1-en-2-yloxan-2-yl]-4-(2-phenylpropan-2-yl)phenoxy]acetic acid |
| SMILES | C=C(C)[C@H]1C[C@H](c2ccccc2)[C@H](c2ccc(Cl)cc2)O[C@@H]1c1cc(C(C)(C)c2ccccc2)ccc1OCC(=O)O |
| InChI | InChI=1S/C37H37ClO4/c1-24(2)30-22-31(25-11-7-5-8-12-25)35(26-15-18-29(38)19-16-26)42-36(30)32-21-28(17-20-33(32)41-23-34(39)40)37(3,4)27-13-9-6-10-14-27/h5-21,30-31,35-36H,1,22-23H2,2-4H3,(H,39,40)/t30-,31-,35+,36+/m1/s1 |
| InChIKey | OBGGAEAZVZUTCT-AANWGISHSA-N |
| XLogP | 9.31 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.15 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|