C28H26Cl2O4 — CID 155989296
2-[5-chloro-2-[(2S,3R,5R,6R)-5-(3-chlorophenyl)-6-phenyl-3-prop-1-en-2-yloxan-2-yl]phenoxy]acetic acid (PubChem CID 155989296) has the molecular formula C28H26Cl2O4 and a molecular weight of 497.42 g/mol. Its IUPAC name is 2-[5-chloro-2-[(2S,3R,5R,6R)-5-(3-chlorophenyl)-6-phenyl-3-prop-1-en-2-yloxan-2-yl]phenoxy]acetic acid.
| Compound Name | 2-[5-chloro-2-[(2S,3R,5R,6R)-5-(3-chlorophenyl)-6-phenyl-3-prop-1-en-2-yloxan-2-yl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 155989296 |
| Molecular Formula | C28H26Cl2O4 |
| Molecular Weight | 497.42 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | 2-[5-chloro-2-[(2S,3R,5R,6R)-5-(3-chlorophenyl)-6-phenyl-3-prop-1-en-2-yloxan-2-yl]phenoxy]acetic acid |
| SMILES | C=C(C)[C@H]1C[C@H](c2cccc(Cl)c2)[C@H](c2ccccc2)O[C@@H]1c1ccc(Cl)cc1OCC(=O)O |
| InChI | InChI=1S/C28H26Cl2O4/c1-17(2)23-15-24(19-9-6-10-20(29)13-19)27(18-7-4-3-5-8-18)34-28(23)22-12-11-21(30)14-25(22)33-16-26(31)32/h3-14,23-24,27-28H,1,15-16H2,2H3,(H,31,32)/t23-,24-,27+,28-/m1/s1 |
| InChIKey | SZMPAZUMECBOKN-KSZYUSJVSA-N |
| XLogP | 7.64 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.42 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|