C26H30Cl2O4 — CID 175657571
2-[4-chloro-2-[(2S,3R,5R,6S)-5-(4-chlorophenyl)-6-propan-2-yl-3-prop-1-en-2-yloxan-2-yl]-5-methylphenoxy]acetic acid (PubChem CID 175657571) has the molecular formula C26H30Cl2O4 and a molecular weight of 477.43 g/mol. Its IUPAC name is 2-[4-chloro-2-[(2S,3R,5R,6S)-5-(4-chlorophenyl)-6-propan-2-yl-3-prop-1-en-2-yloxan-2-yl]-5-methylphenoxy]acetic acid.
| Compound Name | 2-[4-chloro-2-[(2S,3R,5R,6S)-5-(4-chlorophenyl)-6-propan-2-yl-3-prop-1-en-2-yloxan-2-yl]-5-methylphenoxy]acetic acid |
|---|---|
| PubChem CID | 175657571 |
| Molecular Formula | C26H30Cl2O4 |
| Molecular Weight | 477.43 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | 2-[4-chloro-2-[(2S,3R,5R,6S)-5-(4-chlorophenyl)-6-propan-2-yl-3-prop-1-en-2-yloxan-2-yl]-5-methylphenoxy]acetic acid |
| SMILES | C=C(C)[C@H]1C[C@H](c2ccc(Cl)cc2)[C@H](C(C)C)O[C@@H]1c1cc(Cl)c(C)cc1OCC(=O)O |
| InChI | InChI=1S/C26H30Cl2O4/c1-14(2)19-11-20(17-6-8-18(27)9-7-17)25(15(3)4)32-26(19)21-12-22(28)16(5)10-23(21)31-13-24(29)30/h6-10,12,15,19-20,25-26H,1,11,13H2,2-5H3,(H,29,30)/t19-,20-,25+,26+/m1/s1 |
| InChIKey | MDADBEWEEZTFFJ-RGOSMPGBSA-N |
| XLogP | 7.23 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.43 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|