C28H25Cl2FO4 — CID 155989333
2-[5-chloro-2-[(2S,3R,5R,6R)-5-(3-chlorophenyl)-6-(4-fluorophenyl)-3-prop-1-en-2-yloxan-2-yl]phenoxy]acetic acid (PubChem CID 155989333) has the molecular formula C28H25Cl2FO4 and a molecular weight of 515.41 g/mol. Its IUPAC name is 2-[5-chloro-2-[(2S,3R,5R,6R)-5-(3-chlorophenyl)-6-(4-fluorophenyl)-3-prop-1-en-2-yloxan-2-yl]phenoxy]acetic acid.
| Compound Name | 2-[5-chloro-2-[(2S,3R,5R,6R)-5-(3-chlorophenyl)-6-(4-fluorophenyl)-3-prop-1-en-2-yloxan-2-yl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 155989333 |
| Molecular Formula | C28H25Cl2FO4 |
| Molecular Weight | 515.41 g/mol |
| Exact Mass | 514.11 |
| IUPAC Name | 2-[5-chloro-2-[(2S,3R,5R,6R)-5-(3-chlorophenyl)-6-(4-fluorophenyl)-3-prop-1-en-2-yloxan-2-yl]phenoxy]acetic acid |
| SMILES | C=C(C)[C@H]1C[C@H](c2cccc(Cl)c2)[C@H](c2ccc(F)cc2)O[C@@H]1c1ccc(Cl)cc1OCC(=O)O |
| InChI | InChI=1S/C28H25Cl2FO4/c1-16(2)23-14-24(18-4-3-5-19(29)12-18)27(17-6-9-21(31)10-7-17)35-28(23)22-11-8-20(30)13-25(22)34-15-26(32)33/h3-13,23-24,27-28H,1,14-15H2,2H3,(H,32,33)/t23-,24-,27+,28-/m1/s1 |
| InChIKey | GZWPGELEZUUOQF-KSZYUSJVSA-N |
| XLogP | 7.77 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.41 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|